C15H28N3O6S- — CID 91431130
3,3,3-trimorpholin-4-ylpropyl sulfite (PubChem CID 91431130) has the molecular formula C15H28N3O6S- and a molecular weight of 378.47 g/mol. Its IUPAC name is 3,3,3-trimorpholin-4-ylpropyl sulfite.
| Compound Name | 3,3,3-trimorpholin-4-ylpropyl sulfite |
|---|---|
| PubChem CID | 91431130 |
| Molecular Formula | C15H28N3O6S- |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3,3,3-trimorpholin-4-ylpropyl sulfite |
| SMILES | O=S([O-])OCCC(N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H29N3O6S/c19-25(20)24-8-1-15(16-2-9-21-10-3-16,17-4-11-22-12-5-17)18-6-13-23-14-7-18/h1-14H2,(H,19,20)/p-1 |
| InChIKey | KFWOYDQYWDAZJK-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|