C27H30N2O2 — CID 91464510
(6-cyano-3-cyclohexyl-2-phenylindol-1-yl) 3,3-dimethylbutanoate (PubChem CID 91464510) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (6-cyano-3-cyclohexyl-2-phenylindol-1-yl) 3,3-dimethylbutanoate.
| Compound Name | (6-cyano-3-cyclohexyl-2-phenylindol-1-yl) 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 91464510 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (6-cyano-3-cyclohexyl-2-phenylindol-1-yl) 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)On1c(-c2ccccc2)c(C2CCCCC2)c2ccc(C#N)cc21 |
| InChI | InChI=1S/C27H30N2O2/c1-27(2,3)17-24(30)31-29-23-16-19(18-28)14-15-22(23)25(20-10-6-4-7-11-20)26(29)21-12-8-5-9-13-21/h5,8-9,12-16,20H,4,6-7,10-11,17H2,1-3H3 |
| InChIKey | OOCCSZFNHRCNQT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |