C23H32N4O8 — CID 91466786
[3,4-diacetyloxy-6-[5-[(2-methoxyphenyl)methyl]-1-methyl-2H-tetrazol-3-yl]-5-methyloxan-2-yl]methyl acetate (PubChem CID 91466786) has the molecular formula C23H32N4O8 and a molecular weight of 492.53 g/mol. Its IUPAC name is [3,4-diacetyloxy-6-[5-[(2-methoxyphenyl)methyl]-1-methyl-2H-tetrazol-3-yl]-5-methyloxan-2-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-6-[5-[(2-methoxyphenyl)methyl]-1-methyl-2H-tetrazol-3-yl]-5-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91466786 |
| Molecular Formula | C23H32N4O8 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [3,4-diacetyloxy-6-[5-[(2-methoxyphenyl)methyl]-1-methyl-2H-tetrazol-3-yl]-5-methyloxan-2-yl]methyl acetate |
| SMILES | COc1ccccc1CC1=NN(C2OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C2C)NN1C |
| InChI | InChI=1S/C23H32N4O8/c1-13-21(33-15(3)29)22(34-16(4)30)19(12-32-14(2)28)35-23(13)27-24-20(26(5)25-27)11-17-9-7-8-10-18(17)31-6/h7-10,13,19,21-23,25H,11-12H2,1-6H3 |
| InChIKey | UFVNVJCTKMHGNW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|