C20H23F2N5O2 — CID 91479884
2-(2,6-difluorophenyl)-5-[(E)-1-imino-5-piperazin-1-ylhex-2-en-2-yl]-1,3-oxazole-4-carboxamide (PubChem CID 91479884) has the molecular formula C20H23F2N5O2 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-[(E)-1-imino-5-piperazin-1-ylhex-2-en-2-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2,6-difluorophenyl)-5-[(E)-1-imino-5-piperazin-1-ylhex-2-en-2-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 91479884 |
| Molecular Formula | C20H23F2N5O2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-[(E)-1-imino-5-piperazin-1-ylhex-2-en-2-yl]-1,3-oxazole-4-carboxamide |
| SMILES | [H]/N=C/C(=C\CC(C)N1CCNCC1)c1oc(-c2c(F)cccc2F)nc1C(N)=O |
| InChI | InChI=1S/C20H23F2N5O2/c1-12(27-9-7-25-8-10-27)5-6-13(11-23)18-17(19(24)28)26-20(29-18)16-14(21)3-2-4-15(16)22/h2-4,6,11-12,23,25H,5,7-10H2,1H3,(H2,24,28)/b13-6+,23-11+ |
| InChIKey | HEFJWKRUQRDAHK-NISGSQSFSA-N |
| XLogP | 2.44 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|