C11H21N3O5 — CID 91489626
2-[4-(2-amino-1,1,2-trihydroxypropyl)-2-oxopyrrolidin-1-yl]butanamide (PubChem CID 91489626) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[4-(2-amino-1,1,2-trihydroxypropyl)-2-oxopyrrolidin-1-yl]butanamide.
| Compound Name | 2-[4-(2-amino-1,1,2-trihydroxypropyl)-2-oxopyrrolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 91489626 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-[4-(2-amino-1,1,2-trihydroxypropyl)-2-oxopyrrolidin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1CC(C(O)(O)C(C)(N)O)CC1=O |
| InChI | InChI=1S/C11H21N3O5/c1-3-7(9(12)16)14-5-6(4-8(14)15)11(18,19)10(2,13)17/h6-7,17-19H,3-5,13H2,1-2H3,(H2,12,16) |
| InChIKey | GOZIFUIGAKRNAU-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|