C28H32N2O4S — CID 91496575
[5-[3-[4-(4-ethyl-1,3-thiazol-2-yl)-2-propylphenoxy]propoxy]indol-1-yl] propanoate (PubChem CID 91496575) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is [5-[3-[4-(4-ethyl-1,3-thiazol-2-yl)-2-propylphenoxy]propoxy]indol-1-yl] propanoate.
| Compound Name | [5-[3-[4-(4-ethyl-1,3-thiazol-2-yl)-2-propylphenoxy]propoxy]indol-1-yl] propanoate |
|---|---|
| PubChem CID | 91496575 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [5-[3-[4-(4-ethyl-1,3-thiazol-2-yl)-2-propylphenoxy]propoxy]indol-1-yl] propanoate |
| SMILES | CCCc1cc(-c2nc(CC)cs2)ccc1OCCCOc1ccc2c(ccn2OC(=O)CC)c1 |
| InChI | InChI=1S/C28H32N2O4S/c1-4-8-21-17-22(28-29-23(5-2)19-35-28)9-12-26(21)33-16-7-15-32-24-10-11-25-20(18-24)13-14-30(25)34-27(31)6-3/h9-14,17-19H,4-8,15-16H2,1-3H3 |
| InChIKey | SGRUDSBJPUMPNB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|