C23H35N3O7S — CID 91509193
[(2R)-6-amino-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 91509193) has the molecular formula C23H35N3O7S and a molecular weight of 497.61 g/mol. Its IUPAC name is [(2R)-6-amino-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2R)-6-amino-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91509193 |
| Molecular Formula | C23H35N3O7S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | [(2R)-6-amino-2-[(4-methylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)[C@H](CCCCN)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C23H35N3O7S/c1-16-10-12-17(13-11-16)34(30,31)26(22(29)33-23(2,3)4)19(9-5-6-14-24)21(28)32-20(27)18-8-7-15-25-18/h10-13,18-19,25H,5-9,14-15,24H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | ZYUNAQIPJIREOD-RBUKOAKNSA-N |
| XLogP | 2.24 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|