C29H35N3O9S — CID 91340817
[(4-methylphenyl)sulfonyl-[(2S)-1-oxo-3-phenyl-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]amino] 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 91340817) has the molecular formula C29H35N3O9S and a molecular weight of 601.68 g/mol. Its IUPAC name is [(4-methylphenyl)sulfonyl-[(2S)-1-oxo-3-phenyl-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]amino] 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | [(4-methylphenyl)sulfonyl-[(2S)-1-oxo-3-phenyl-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]amino] 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 91340817 |
| Molecular Formula | C29H35N3O9S |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | [(4-methylphenyl)sulfonyl-[(2S)-1-oxo-3-phenyl-1-[(2S)-pyrrolidine-2-carbonyl]oxypropan-2-yl]amino] 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N(OC(=O)N2CCC3(CC2)OCCO3)[C@@H](Cc2ccccc2)C(=O)OC(=O)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C29H35N3O9S/c1-21-9-11-23(12-10-21)42(36,37)32(41-28(35)31-16-13-29(14-17-31)38-18-19-39-29)25(20-22-6-3-2-4-7-22)27(34)40-26(33)24-8-5-15-30-24/h2-4,6-7,9-12,24-25,30H,5,8,13-20H2,1H3/t24-,25-/m0/s1 |
| InChIKey | UUQMEDCWEOWWNI-DQEYMECFSA-N |
| XLogP | 2.31 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|