C22H31NO5S — CID 102085453
tert-butyl N-[(Z,1R)-1-cyclohexyl-4-oxobut-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 102085453) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is tert-butyl N-[(Z,1R)-1-cyclohexyl-4-oxobut-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[(Z,1R)-1-cyclohexyl-4-oxobut-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 102085453 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl N-[(Z,1R)-1-cyclohexyl-4-oxobut-2-enyl]-N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)OC(C)(C)C)[C@@H](/C=C\C=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H31NO5S/c1-17-12-14-19(15-13-17)29(26,27)23(21(25)28-22(2,3)4)20(11-8-16-24)18-9-6-5-7-10-18/h8,11-16,18,20H,5-7,9-10H2,1-4H3/b11-8-/t20-/m0/s1 |
| InChIKey | YBQPAZJAKPQXKN-WUQYLLKWSA-N |
| XLogP | 4.62 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|