C22H30BN4O2+ — CID 91510089
5-(2,2-dimethylpropyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-5-ium (PubChem CID 91510089) has the molecular formula C22H30BN4O2+ and a molecular weight of 393.32 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-5-ium.
| Compound Name | 5-(2,2-dimethylpropyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-5-ium |
|---|---|
| PubChem CID | 91510089 |
| Molecular Formula | C22H30BN4O2+ |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-5-ium |
| SMILES | CC(C)(C)C[n+]1cnc2c(cnn2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1 |
| InChI | InChI=1S/C22H30BN4O2/c1-20(2,3)14-26-13-16-12-25-27(19(16)24-15-26)18-10-8-17(9-11-18)23-28-21(4,5)22(6,7)29-23/h8-13,15H,14H2,1-7H3/q+1 |
| InChIKey | IZHIMOQXFRRVLY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|