C7H10N2O3 — CID 91511804
2-methoxy-N,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 91511804) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-methoxy-N,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | 2-methoxy-N,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91511804 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-methoxy-N,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | CNC(=O)c1oc(OC)nc1C |
| InChI | InChI=1S/C7H10N2O3/c1-4-5(6(10)8-2)12-7(9-4)11-3/h1-3H3,(H,8,10) |
| InChIKey | GEGJMIRSPXVUNK-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |