C8H8N2O2S2 — CID 91520182
2H-1,4-benzothiazine-6-sulfonamide (PubChem CID 91520182) has the molecular formula C8H8N2O2S2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2H-1,4-benzothiazine-6-sulfonamide.
| Compound Name | 2H-1,4-benzothiazine-6-sulfonamide |
|---|---|
| PubChem CID | 91520182 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | 2H-1,4-benzothiazine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2c(c1)N=CCS2 |
| InChI | InChI=1S/C8H8N2O2S2/c9-14(11,12)6-1-2-8-7(5-6)10-3-4-13-8/h1-3,5H,4H2,(H2,9,11,12) |
| InChIKey | JNHISOCELOKSKO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |