C11H18Cl3NO9 — CID 91528330
(3,4,5,6,7,8,9-heptahydroxy-1-oxononan-2-yl) 2,2,2-trichloroethanimidate (PubChem CID 91528330) has the molecular formula C11H18Cl3NO9 and a molecular weight of 414.62 g/mol. Its IUPAC name is (3,4,5,6,7,8,9-heptahydroxy-1-oxononan-2-yl) 2,2,2-trichloroethanimidate.
| Compound Name | (3,4,5,6,7,8,9-heptahydroxy-1-oxononan-2-yl) 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 91528330 |
| Molecular Formula | C11H18Cl3NO9 |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (3,4,5,6,7,8,9-heptahydroxy-1-oxononan-2-yl) 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC(C=O)C(O)C(O)C(O)C(O)C(O)C(O)CO)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO9/c12-11(13,14)10(15)24-4(2-17)6(20)8(22)9(23)7(21)5(19)3(18)1-16/h2-9,15-16,18-23H,1H2/b15-10+ |
| InChIKey | SBTPZYFNUIGAGO-XNTDXEJSSA-N |
| XLogP | -2.92 |
| TPSA | 191.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|