C12H18Cl3NO11 — CID 90995999
(2-carboxyoxy-4,5,6,7,8,9-hexahydroxy-1-oxononan-3-yl) 2,2,2-trichloroethanimidate (PubChem CID 90995999) has the molecular formula C12H18Cl3NO11 and a molecular weight of 458.63 g/mol. Its IUPAC name is (2-carboxyoxy-4,5,6,7,8,9-hexahydroxy-1-oxononan-3-yl) 2,2,2-trichloroethanimidate.
| Compound Name | (2-carboxyoxy-4,5,6,7,8,9-hexahydroxy-1-oxononan-3-yl) 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 90995999 |
| Molecular Formula | C12H18Cl3NO11 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 456.99 |
| IUPAC Name | (2-carboxyoxy-4,5,6,7,8,9-hexahydroxy-1-oxononan-3-yl) 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC(C(C=O)OC(=O)O)C(O)C(O)C(O)C(O)C(O)CO)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO11/c13-12(14,15)10(16)27-9(4(2-18)26-11(24)25)8(23)7(22)6(21)5(20)3(19)1-17/h2-9,16-17,19-23H,1H2,(H,24,25)/b16-10+ |
| InChIKey | WYQIBFYDUIVASL-MHWRWJLKSA-N |
| XLogP | -2.22 |
| TPSA | 218.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|