C10H14N2 — CID 91535320
1,9-diazatricyclo[6.3.1.04,12]dodeca-2,6-diene (PubChem CID 91535320) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,9-diazatricyclo[6.3.1.04,12]dodeca-2,6-diene.
| Compound Name | 1,9-diazatricyclo[6.3.1.04,12]dodeca-2,6-diene |
|---|---|
| PubChem CID | 91535320 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,9-diazatricyclo[6.3.1.04,12]dodeca-2,6-diene |
| SMILES | C1=CC2NCCN3C=CC(C1)C23 |
| InChI | InChI=1S/C10H14N2/c1-2-8-4-6-12-7-5-11-9(3-1)10(8)12/h1,3-4,6,8-11H,2,5,7H2 |
| InChIKey | XVNNLGBVVBBHRN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|