C11H12FN7O — CID 91558444
N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-amine (PubChem CID 91558444) has the molecular formula C11H12FN7O and a molecular weight of 277.26 g/mol. Its IUPAC name is N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-amine.
| Compound Name | N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-amine |
|---|---|
| PubChem CID | 91558444 |
| Molecular Formula | C11H12FN7O |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-6-amine |
| SMILES | NNc1ncc(F)c(Nc2ccc3c(n2)NCCO3)n1 |
| InChI | InChI=1S/C11H12FN7O/c12-6-5-15-11(19-13)18-9(6)16-8-2-1-7-10(17-8)14-3-4-20-7/h1-2,5H,3-4,13H2,(H3,14,15,16,17,18,19) |
| InChIKey | YRAOVHVMAKSSCI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|