C24H40BNO4Si — CID 91563314
[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-oxo-4-phenylbutanoyl)piperidin-1-yl]-methylborinic acid (PubChem CID 91563314) has the molecular formula C24H40BNO4Si and a molecular weight of 445.49 g/mol. Its IUPAC name is [4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-oxo-4-phenylbutanoyl)piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-oxo-4-phenylbutanoyl)piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 91563314 |
| Molecular Formula | C24H40BNO4Si |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(3-oxo-4-phenylbutanoyl)piperidin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCC(CCO[Si](C)(C)C(C)(C)C)(C(=O)CC(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H40BNO4Si/c1-23(2,3)31(5,6)30-17-14-24(12-15-26(16-13-24)25(4)29)22(28)19-21(27)18-20-10-8-7-9-11-20/h7-11,29H,12-19H2,1-6H3 |
| InChIKey | HISYMVMKIYXFSQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|