C15H16N2O5 — CID 91569165
3-[2-(3,4-dimethoxyphenyl)ethenyl]-4-(oxiran-2-ylmethyl)-1,2,4-oxadiazol-5-one (PubChem CID 91569165) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethenyl]-4-(oxiran-2-ylmethyl)-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethenyl]-4-(oxiran-2-ylmethyl)-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 91569165 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethenyl]-4-(oxiran-2-ylmethyl)-1,2,4-oxadiazol-5-one |
| SMILES | COc1ccc(C=Cc2noc(=O)n2CC2CO2)cc1OC |
| InChI | InChI=1S/C15H16N2O5/c1-19-12-5-3-10(7-13(12)20-2)4-6-14-16-22-15(18)17(14)8-11-9-21-11/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | CDHHGCFOBNAEEJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|