C5H6F5N3 — CID 91570058
3,3,4,4,4-pentafluoro-N-(methyldiazenyl)butan-1-imine (PubChem CID 91570058) has the molecular formula C5H6F5N3 and a molecular weight of 203.11 g/mol. Its IUPAC name is 3,3,4,4,4-pentafluoro-N-(methyldiazenyl)butan-1-imine.
| Compound Name | 3,3,4,4,4-pentafluoro-N-(methyldiazenyl)butan-1-imine |
|---|---|
| PubChem CID | 91570058 |
| Molecular Formula | C5H6F5N3 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3,3,4,4,4-pentafluoro-N-(methyldiazenyl)butan-1-imine |
| SMILES | C/N=N/N=CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F5N3/c1-11-13-12-3-2-4(6,7)5(8,9)10/h3H,2H2,1H3/b12-3?,13-11+ |
| InChIKey | LSVXRXCFRCTQEZ-KJQUKPIUSA-N |
| XLogP | 2.64 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|