C16H24O5 — CID 91575534
4-(1-hydroxy-2-phenylmethoxyethyl)-4-propyloxolane-2,2-diol (PubChem CID 91575534) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 4-(1-hydroxy-2-phenylmethoxyethyl)-4-propyloxolane-2,2-diol.
| Compound Name | 4-(1-hydroxy-2-phenylmethoxyethyl)-4-propyloxolane-2,2-diol |
|---|---|
| PubChem CID | 91575534 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-(1-hydroxy-2-phenylmethoxyethyl)-4-propyloxolane-2,2-diol |
| SMILES | CCCC1(C(O)COCc2ccccc2)COC(O)(O)C1 |
| InChI | InChI=1S/C16H24O5/c1-2-8-15(11-16(18,19)21-12-15)14(17)10-20-9-13-6-4-3-5-7-13/h3-7,14,17-19H,2,8-12H2,1H3 |
| InChIKey | JLDCROBEHUIUMU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|