C15H23N3O6S — CID 91575728
[1-[(1-oxidopyridin-1-ium-3-carbonyl)amino]oxy-3-piperidin-1-ylpropan-2-yl] methanesulfonate (PubChem CID 91575728) has the molecular formula C15H23N3O6S and a molecular weight of 373.43 g/mol. Its IUPAC name is [1-[(1-oxidopyridin-1-ium-3-carbonyl)amino]oxy-3-piperidin-1-ylpropan-2-yl] methanesulfonate.
| Compound Name | [1-[(1-oxidopyridin-1-ium-3-carbonyl)amino]oxy-3-piperidin-1-ylpropan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 91575728 |
| Molecular Formula | C15H23N3O6S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [1-[(1-oxidopyridin-1-ium-3-carbonyl)amino]oxy-3-piperidin-1-ylpropan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(CONC(=O)c1ccc[n+]([O-])c1)CN1CCCCC1 |
| InChI | InChI=1S/C15H23N3O6S/c1-25(21,22)24-14(11-17-7-3-2-4-8-17)12-23-16-15(19)13-6-5-9-18(20)10-13/h5-6,9-10,14H,2-4,7-8,11-12H2,1H3,(H,16,19) |
| InChIKey | PIEYTVJORAETNY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|