C21H34FO4P — CID 91598542
fluoro(2-methylicosa-5,8,11,14-tetraenoyloxy)phosphinic acid (PubChem CID 91598542) has the molecular formula C21H34FO4P and a molecular weight of 400.47 g/mol. Its IUPAC name is fluoro(2-methylicosa-5,8,11,14-tetraenoyloxy)phosphinic acid.
| Compound Name | fluoro(2-methylicosa-5,8,11,14-tetraenoyloxy)phosphinic acid |
|---|---|
| PubChem CID | 91598542 |
| Molecular Formula | C21H34FO4P |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | fluoro(2-methylicosa-5,8,11,14-tetraenoyloxy)phosphinic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCC(C)C(=O)OP(=O)(O)F |
| InChI | InChI=1S/C21H34FO4P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)21(23)26-27(22,24)25/h7-8,10-11,13-14,16-17,20H,3-6,9,12,15,18-19H2,1-2H3,(H,24,25) |
| InChIKey | ILVFVPMFNMHBFI-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|