C18H27FN2O2 — CID 91601101
6-[4-(5-fluoro-2-methylhexa-2,4-dien-3-yl)piperidine-1-carbonyl]piperidin-2-one (PubChem CID 91601101) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 6-[4-(5-fluoro-2-methylhexa-2,4-dien-3-yl)piperidine-1-carbonyl]piperidin-2-one.
| Compound Name | 6-[4-(5-fluoro-2-methylhexa-2,4-dien-3-yl)piperidine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 91601101 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 6-[4-(5-fluoro-2-methylhexa-2,4-dien-3-yl)piperidine-1-carbonyl]piperidin-2-one |
| SMILES | CC(F)=CC(=C(C)C)C1CCN(C(=O)C2CCCC(=O)N2)CC1 |
| InChI | InChI=1S/C18H27FN2O2/c1-12(2)15(11-13(3)19)14-7-9-21(10-8-14)18(23)16-5-4-6-17(22)20-16/h11,14,16H,4-10H2,1-3H3,(H,20,22) |
| InChIKey | JSZAUGWOGUXZPB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|