C16H23N5O5 — CID 91605430
3-acetamido-N-methyl-N'-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methyl]pentanediamide (PubChem CID 91605430) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-acetamido-N-methyl-N'-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methyl]pentanediamide.
| Compound Name | 3-acetamido-N-methyl-N'-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methyl]pentanediamide |
|---|---|
| PubChem CID | 91605430 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 3-acetamido-N-methyl-N'-[[[2-(2-methylidene-5-oxopyrrol-1-yl)acetyl]amino]methyl]pentanediamide |
| SMILES | C=C1C=CC(=O)N1CC(=O)NCNC(=O)CC(CC(=O)NC)NC(C)=O |
| InChI | InChI=1S/C16H23N5O5/c1-10-4-5-16(26)21(10)8-15(25)19-9-18-14(24)7-12(20-11(2)22)6-13(23)17-3/h4-5,12H,1,6-9H2,2-3H3,(H,17,23)(H,18,24)(H,19,25)(H,20,22) |
| InChIKey | YLSPQQUOGZHGIQ-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|