C29H27F5N2O2 — CID 91606605
4,4-bis(4-fluorophenyl)-1-[4-[[4-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 91606605) has the molecular formula C29H27F5N2O2 and a molecular weight of 530.54 g/mol. Its IUPAC name is 4,4-bis(4-fluorophenyl)-1-[4-[[4-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 4,4-bis(4-fluorophenyl)-1-[4-[[4-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 91606605 |
| Molecular Formula | C29H27F5N2O2 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4,4-bis(4-fluorophenyl)-1-[4-[[4-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | O=C(CCC(c1ccc(F)cc1)c1ccc(F)cc1)N1CC=C(NOCc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C29H27F5N2O2/c30-24-9-3-21(4-10-24)27(22-5-11-25(31)12-6-22)13-14-28(37)36-17-15-26(16-18-36)35-38-19-20-1-7-23(8-2-20)29(32,33)34/h1-12,15,27,35H,13-14,16-19H2 |
| InChIKey | IOQPKSZUCREKKN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|