C10H8Cl2N2O4 — CID 91608194
2,2-dichloro-1-(1,2-dicyano-3-methoxy-3-oxopropyl)cyclopropane-1-carboxylic acid (PubChem CID 91608194) has the molecular formula C10H8Cl2N2O4 and a molecular weight of 291.09 g/mol. Its IUPAC name is 2,2-dichloro-1-(1,2-dicyano-3-methoxy-3-oxopropyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2,2-dichloro-1-(1,2-dicyano-3-methoxy-3-oxopropyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 91608194 |
| Molecular Formula | C10H8Cl2N2O4 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2,2-dichloro-1-(1,2-dicyano-3-methoxy-3-oxopropyl)cyclopropane-1-carboxylic acid |
| SMILES | COC(=O)C(C#N)C(C#N)C1(C(=O)O)CC1(Cl)Cl |
| InChI | InChI=1S/C10H8Cl2N2O4/c1-18-7(15)5(2-13)6(3-14)9(8(16)17)4-10(9,11)12/h5-6H,4H2,1H3,(H,16,17) |
| InChIKey | CQBIZKIBBHPRDD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|