C10H10N2OS — CID 91621048
2-[(E)-(2-amino-1,3-thiazol-4-ylidene)methyl]phenol (PubChem CID 91621048) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-[(E)-(2-amino-1,3-thiazol-4-ylidene)methyl]phenol.
| Compound Name | 2-[(E)-(2-amino-1,3-thiazol-4-ylidene)methyl]phenol |
|---|---|
| PubChem CID | 91621048 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-[(E)-(2-amino-1,3-thiazol-4-ylidene)methyl]phenol |
| SMILES | NC1=N/C(=C/c2ccccc2O)CS1 |
| InChI | InChI=1S/C10H10N2OS/c11-10-12-8(6-14-10)5-7-3-1-2-4-9(7)13/h1-5,13H,6H2,(H2,11,12)/b8-5+ |
| InChIKey | WNZGVZRQJGYFPL-VMPITWQZSA-N |
| XLogP | 1.79 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |