C15H11F15N2O4 — CID 91691816
N-acetyl-N-[4-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]butyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91691816) has the molecular formula C15H11F15N2O4 and a molecular weight of 568.23 g/mol. Its IUPAC name is N-acetyl-N-[4-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]butyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-acetyl-N-[4-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]butyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91691816 |
| Molecular Formula | C15H11F15N2O4 |
| Molecular Weight | 568.23 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | N-acetyl-N-[4-[bis(2,2,3,3,3-pentafluoropropanoyl)amino]butyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CC(=O)N(CCCCN(C(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11F15N2O4/c1-6(33)31(7(34)10(16,17)13(22,23)24)4-2-3-5-32(8(35)11(18,19)14(25,26)27)9(36)12(20,21)15(28,29)30/h2-5H2,1H3 |
| InChIKey | IBMUXMDJFZHDRI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|