C19H43NO5Si3 — CID 91696503
trimethylsilyl 4-[[3,3-dimethyl-2,4-bis(trimethylsilyloxy)butanoyl]amino]butanoate (PubChem CID 91696503) has the molecular formula C19H43NO5Si3 and a molecular weight of 449.81 g/mol. Its IUPAC name is trimethylsilyl 4-[[3,3-dimethyl-2,4-bis(trimethylsilyloxy)butanoyl]amino]butanoate.
| Compound Name | trimethylsilyl 4-[[3,3-dimethyl-2,4-bis(trimethylsilyloxy)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 91696503 |
| Molecular Formula | C19H43NO5Si3 |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | trimethylsilyl 4-[[3,3-dimethyl-2,4-bis(trimethylsilyloxy)butanoyl]amino]butanoate |
| SMILES | CC(C)(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)NCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C19H43NO5Si3/c1-19(2,15-23-26(3,4)5)17(25-28(9,10)11)18(22)20-14-12-13-16(21)24-27(6,7)8/h17H,12-15H2,1-11H3,(H,20,22) |
| InChIKey | YZQWRGLTYHDPRQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|