C22H26F6O2Si — CID 91698383
2,2,3,4,4,4-hexafluorobutoxy-(4-methylpentoxy)-diphenylsilane (PubChem CID 91698383) has the molecular formula C22H26F6O2Si and a molecular weight of 464.52 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluorobutoxy-(4-methylpentoxy)-diphenylsilane.
| Compound Name | 2,2,3,4,4,4-hexafluorobutoxy-(4-methylpentoxy)-diphenylsilane |
|---|---|
| PubChem CID | 91698383 |
| Molecular Formula | C22H26F6O2Si |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2,2,3,4,4,4-hexafluorobutoxy-(4-methylpentoxy)-diphenylsilane |
| SMILES | CC(C)CCCO[Si](OCC(F)(F)C(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26F6O2Si/c1-17(2)10-9-15-29-31(18-11-5-3-6-12-18,19-13-7-4-8-14-19)30-16-21(24,25)20(23)22(26,27)28/h3-8,11-14,17,20H,9-10,15-16H2,1-2H3 |
| InChIKey | QEQVCUCWBJOCTF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|