C21H26BrF3O2Si — CID 91698288
(3-bromo-1,1,1-trifluoropropan-2-yl)oxy-(4-methylpentoxy)-diphenylsilane (PubChem CID 91698288) has the molecular formula C21H26BrF3O2Si and a molecular weight of 475.42 g/mol. Its IUPAC name is (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-(4-methylpentoxy)-diphenylsilane.
| Compound Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-(4-methylpentoxy)-diphenylsilane |
|---|---|
| PubChem CID | 91698288 |
| Molecular Formula | C21H26BrF3O2Si |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-(4-methylpentoxy)-diphenylsilane |
| SMILES | CC(C)CCCO[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26BrF3O2Si/c1-17(2)10-9-15-26-28(18-11-5-3-6-12-18,19-13-7-4-8-14-19)27-20(16-22)21(23,24)25/h3-8,11-14,17,20H,9-10,15-16H2,1-2H3 |
| InChIKey | HRCJPVXBDUTGGB-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|