C20H24BrF3O2Si — CID 91699427
(3-bromo-1,1,1-trifluoropropan-2-yl)oxy-pentoxy-diphenylsilane (PubChem CID 91699427) has the molecular formula C20H24BrF3O2Si and a molecular weight of 461.39 g/mol. Its IUPAC name is (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-pentoxy-diphenylsilane.
| Compound Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-pentoxy-diphenylsilane |
|---|---|
| PubChem CID | 91699427 |
| Molecular Formula | C20H24BrF3O2Si |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | (3-bromo-1,1,1-trifluoropropan-2-yl)oxy-pentoxy-diphenylsilane |
| SMILES | CCCCCO[Si](OC(CBr)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24BrF3O2Si/c1-2-3-10-15-25-27(17-11-6-4-7-12-17,18-13-8-5-9-14-18)26-19(16-21)20(22,23)24/h4-9,11-14,19H,2-3,10,15-16H2,1H3 |
| InChIKey | DNLFCPXPXYFRHQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|