C17H20O4 — CID 91715936
(10,12,12-trimethyl-3,6-dioxo-1-tricyclo[6.2.2.02,7]dodeca-4,9-dienyl) acetate (PubChem CID 91715936) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (10,12,12-trimethyl-3,6-dioxo-1-tricyclo[6.2.2.02,7]dodeca-4,9-dienyl) acetate.
| Compound Name | (10,12,12-trimethyl-3,6-dioxo-1-tricyclo[6.2.2.02,7]dodeca-4,9-dienyl) acetate |
|---|---|
| PubChem CID | 91715936 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (10,12,12-trimethyl-3,6-dioxo-1-tricyclo[6.2.2.02,7]dodeca-4,9-dienyl) acetate |
| SMILES | CC(=O)OC12CC(C)(C)C(C=C1C)C1C(=O)C=CC(=O)C12 |
| InChI | InChI=1S/C17H20O4/c1-9-7-11-14-12(19)5-6-13(20)15(14)17(9,21-10(2)18)8-16(11,3)4/h5-7,11,14-15H,8H2,1-4H3 |
| InChIKey | JMAJEHMBHUMWMW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|