C29H37BN2 — CID 91745121
(2-methyl-4-piperazin-1-ylphenyl)-bis(2,4,6-trimethylphenyl)borane (PubChem CID 91745121) has the molecular formula C29H37BN2 and a molecular weight of 424.44 g/mol. Its IUPAC name is (2-methyl-4-piperazin-1-ylphenyl)-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | (2-methyl-4-piperazin-1-ylphenyl)-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 91745121 |
| Molecular Formula | C29H37BN2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (2-methyl-4-piperazin-1-ylphenyl)-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc(N3CCNCC3)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C29H37BN2/c1-19-14-22(4)28(23(5)15-19)30(29-24(6)16-20(2)17-25(29)7)27-9-8-26(18-21(27)3)32-12-10-31-11-13-32/h8-9,14-18,31H,10-13H2,1-7H3 |
| InChIKey | YSWJCLOTHVGOOE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|