C13H18N2O4S — CID 91769370
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(1-methylpyrrol-2-yl)-2-oxoacetamide (PubChem CID 91769370) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(1-methylpyrrol-2-yl)-2-oxoacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(1-methylpyrrol-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 91769370 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2-(1-methylpyrrol-2-yl)-2-oxoacetamide |
| SMILES | CCN(C(=O)C(=O)c1cccn1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O4S/c1-3-15(10-6-8-20(18,19)9-10)13(17)12(16)11-5-4-7-14(11)2/h4-5,7,10H,3,6,8-9H2,1-2H3 |
| InChIKey | UGLOBPQXOKDMIU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|