C12H19N5S — CID 91773444
4-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]thiomorpholine (PubChem CID 91773444) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is 4-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]thiomorpholine.
| Compound Name | 4-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]thiomorpholine |
|---|---|
| PubChem CID | 91773444 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-[1-(1,3,5-triazin-2-yl)piperidin-4-yl]thiomorpholine |
| SMILES | c1ncnc(N2CCC(N3CCSCC3)CC2)n1 |
| InChI | InChI=1S/C12H19N5S/c1-3-17(12-14-9-13-10-15-12)4-2-11(1)16-5-7-18-8-6-16/h9-11H,1-8H2 |
| InChIKey | WPJRZCCHZVRPSY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |