C28H33F2N3O2+2 — CID 91803530
3-(7-ethyl-9,11-difluoro-7-methyl-2-pentyl-6H-benzo[a]quinolizin-5-ium-6-yl)-5,6-dimethyl-3H-imidazo[1,5-c][1,3]oxazol-6-ium-1-one (PubChem CID 91803530) has the molecular formula C28H33F2N3O2+2 and a molecular weight of 481.59 g/mol. Its IUPAC name is 3-(7-ethyl-9,11-difluoro-7-methyl-2-pentyl-6H-benzo[a]quinolizin-5-ium-6-yl)-5,6-dimethyl-3H-imidazo[1,5-c][1,3]oxazol-6-ium-1-one.
| Compound Name | 3-(7-ethyl-9,11-difluoro-7-methyl-2-pentyl-6H-benzo[a]quinolizin-5-ium-6-yl)-5,6-dimethyl-3H-imidazo[1,5-c][1,3]oxazol-6-ium-1-one |
|---|---|
| PubChem CID | 91803530 |
| Molecular Formula | C28H33F2N3O2+2 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 3-(7-ethyl-9,11-difluoro-7-methyl-2-pentyl-6H-benzo[a]quinolizin-5-ium-6-yl)-5,6-dimethyl-3H-imidazo[1,5-c][1,3]oxazol-6-ium-1-one |
| SMILES | CCCCCc1cc[n+]2c(c1)-c1c(F)cc(F)cc1C(C)(CC)C2C1OC(=O)c2c[n+](C)c(C)n21 |
| InChI | InChI=1S/C28H33F2N3O2/c1-6-8-9-10-18-11-12-32-22(13-18)24-20(14-19(29)15-21(24)30)28(4,7-2)25(32)26-33-17(3)31(5)16-23(33)27(34)35-26/h11-16,25-26H,6-10H2,1-5H3/q+2 |
| InChIKey | YOALFWXVSIKRGA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|