C12H20N4O — CID 91805360
2-azido-N-(2,6-dimethylocta-2,6-dienyl)acetamide (PubChem CID 91805360) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-azido-N-(2,6-dimethylocta-2,6-dienyl)acetamide.
| Compound Name | 2-azido-N-(2,6-dimethylocta-2,6-dienyl)acetamide |
|---|---|
| PubChem CID | 91805360 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-azido-N-(2,6-dimethylocta-2,6-dienyl)acetamide |
| SMILES | CC=C(C)CCC=C(C)CNC(=O)CN=[N+]=[N-] |
| InChI | InChI=1S/C12H20N4O/c1-4-10(2)6-5-7-11(3)8-14-12(17)9-15-16-13/h4,7H,5-6,8-9H2,1-3H3,(H,14,17) |
| InChIKey | VATPULAOSSJQRC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|