C18H15Cl2NO4S — CID 91873057
methyl 3-[5-[[(2,4-dichlorophenyl)methoxyamino]methyl]furan-2-yl]thiophene-2-carboxylate (PubChem CID 91873057) has the molecular formula C18H15Cl2NO4S and a molecular weight of 412.29 g/mol. Its IUPAC name is methyl 3-[5-[[(2,4-dichlorophenyl)methoxyamino]methyl]furan-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-[[(2,4-dichlorophenyl)methoxyamino]methyl]furan-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 91873057 |
| Molecular Formula | C18H15Cl2NO4S |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | methyl 3-[5-[[(2,4-dichlorophenyl)methoxyamino]methyl]furan-2-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1ccc(CNOCc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C18H15Cl2NO4S/c1-23-18(22)17-14(6-7-26-17)16-5-4-13(25-16)9-21-24-10-11-2-3-12(19)8-15(11)20/h2-8,21H,9-10H2,1H3 |
| InChIKey | FBSWGGBVOJEIPT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|