C19H15Cl2N3O3S2 — CID 2739701
methyl 3-[5-[N-[(2,4-dichlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]furan-2-yl]thiophene-2-carboxylate (PubChem CID 2739701) has the molecular formula C19H15Cl2N3O3S2 and a molecular weight of 468.39 g/mol. Its IUPAC name is methyl 3-[5-[N-[(2,4-dichlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]furan-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-[N-[(2,4-dichlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]furan-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2739701 |
| Molecular Formula | C19H15Cl2N3O3S2 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | methyl 3-[5-[N-[(2,4-dichlorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]furan-2-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1ccc(C(C)=NNC(=S)Nc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C19H15Cl2N3O3S2/c1-10(23-24-19(28)22-14-4-3-11(20)9-13(14)21)15-5-6-16(27-15)12-7-8-29-17(12)18(25)26-2/h3-9H,1-2H3,(H2,22,24,28) |
| InChIKey | TZQKINJPQBFRTG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|