C18H13Cl2NO4S — CID 2764730
methyl 3-[5-[(2,4-dichlorophenyl)methoxyiminomethyl]furan-2-yl]thiophene-2-carboxylate (PubChem CID 2764730) has the molecular formula C18H13Cl2NO4S and a molecular weight of 410.28 g/mol. Its IUPAC name is methyl 3-[5-[(2,4-dichlorophenyl)methoxyiminomethyl]furan-2-yl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[5-[(2,4-dichlorophenyl)methoxyiminomethyl]furan-2-yl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2764730 |
| Molecular Formula | C18H13Cl2NO4S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | methyl 3-[5-[(2,4-dichlorophenyl)methoxyiminomethyl]furan-2-yl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1-c1ccc(C=NOCc2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C18H13Cl2NO4S/c1-23-18(22)17-14(6-7-26-17)16-5-4-13(25-16)9-21-24-10-11-2-3-12(19)8-15(11)20/h2-9H,10H2,1H3 |
| InChIKey | DPAXQIMKYKBABP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|