C16H10Cl3NO3 — CID 134114772
6-chloro-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]-3H-2-benzofuran-1-one (PubChem CID 134114772) has the molecular formula C16H10Cl3NO3 and a molecular weight of 370.62 g/mol. Its IUPAC name is 6-chloro-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]-3H-2-benzofuran-1-one.
| Compound Name | 6-chloro-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134114772 |
| Molecular Formula | C16H10Cl3NO3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 6-chloro-3-[(E)-(2,4-dichlorophenyl)methoxyiminomethyl]-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(/C=N/OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H10Cl3NO3/c17-10-3-4-12-13(5-10)16(21)23-15(12)7-20-22-8-9-1-2-11(18)6-14(9)19/h1-7,15H,8H2/b20-7+ |
| InChIKey | LLRGPBIIBBWTGB-IFRROFPPSA-N |
| XLogP | 5.06 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|