C17H20BNO3S — CID 91901639
[4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-phenylmethanone (PubChem CID 91901639) has the molecular formula C17H20BNO3S and a molecular weight of 329.23 g/mol. Its IUPAC name is [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-phenylmethanone.
| Compound Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 91901639 |
| Molecular Formula | C17H20BNO3S |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]-phenylmethanone |
| SMILES | Cc1nc(C(=O)c2ccccc2)sc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H20BNO3S/c1-11-14(18-21-16(2,3)17(4,5)22-18)23-15(19-11)13(20)12-9-7-6-8-10-12/h6-10H,1-5H3 |
| InChIKey | LCJQFHBSHJRTBC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|