C17H28NO6P-2 — CID 91935480
[2-oxo-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]amino]ethyl] phosphate (PubChem CID 91935480) has the molecular formula C17H28NO6P-2 and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-oxo-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]amino]ethyl] phosphate.
| Compound Name | [2-oxo-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]amino]ethyl] phosphate |
|---|---|
| PubChem CID | 91935480 |
| Molecular Formula | C17H28NO6P-2 |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-oxo-2-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]amino]ethyl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CONC(=O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C17H30NO6P/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-23-18-17(19)13-24-25(20,21)22/h7,9,11H,5-6,8,10,12-13H2,1-4H3,(H,18,19)(H2,20,21,22)/p-2/b15-9+,16-11+ |
| InChIKey | RMCWKOUAIHAKDP-XGGJEREUSA-L |
| XLogP | 2.30 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|