C25H44NO5P — CID 173216504
[2-methyl-4-oxo-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphonic acid (PubChem CID 173216504) has the molecular formula C25H44NO5P and a molecular weight of 469.60 g/mol. Its IUPAC name is [2-methyl-4-oxo-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphonic acid.
| Compound Name | [2-methyl-4-oxo-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 173216504 |
| Molecular Formula | C25H44NO5P |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | [2-methyl-4-oxo-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCONC(=O)CC(C)(C)P(=O)(O)O |
| InChI | InChI=1S/C25H44NO5P/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-23(5)17-18-31-26-24(27)19-25(6,7)32(28,29)30/h11,13,15,17H,8-10,12,14,16,18-19H2,1-7H3,(H,26,27)(H2,28,29,30) |
| InChIKey | SNQKIFVLRVQSRW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|