C24H41NO2 — CID 173290198
N-[(2E,6E,10E)-3,7,11,13-tetramethylhexadeca-2,6,10,14-tetraenoxy]butanamide (PubChem CID 173290198) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is N-[(2E,6E,10E)-3,7,11,13-tetramethylhexadeca-2,6,10,14-tetraenoxy]butanamide.
| Compound Name | N-[(2E,6E,10E)-3,7,11,13-tetramethylhexadeca-2,6,10,14-tetraenoxy]butanamide |
|---|---|
| PubChem CID | 173290198 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | N-[(2E,6E,10E)-3,7,11,13-tetramethylhexadeca-2,6,10,14-tetraenoxy]butanamide |
| SMILES | CC=CC(C)C/C(C)=C/CC/C(C)=C/CC/C(C)=C/CONC(=O)CCC |
| InChI | InChI=1S/C24H41NO2/c1-7-11-22(5)19-23(6)16-10-14-20(3)13-9-15-21(4)17-18-27-25-24(26)12-8-2/h7,11,13,16-17,22H,8-10,12,14-15,18-19H2,1-6H3,(H,25,26)/b11-7?,20-13+,21-17+,23-16+ |
| InChIKey | PNTAYXFVUZBXID-ARKJWKBQSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|