C24H41NO4P+ — CID 173216626
hydroxy-oxo-[1-oxo-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphanium (PubChem CID 173216626) has the molecular formula C24H41NO4P+ and a molecular weight of 438.57 g/mol. Its IUPAC name is hydroxy-oxo-[1-oxo-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphanium.
| Compound Name | hydroxy-oxo-[1-oxo-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphanium |
|---|---|
| PubChem CID | 173216626 |
| Molecular Formula | C24H41NO4P+ |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | hydroxy-oxo-[1-oxo-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxyamino)butan-2-yl]phosphanium |
| SMILES | CCC(C(=O)NOCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)[P+](=O)O |
| InChI | InChI=1S/C24H40NO4P/c1-7-23(30(27)28)24(26)25-29-18-17-22(6)16-10-15-21(5)14-9-13-20(4)12-8-11-19(2)3/h11,13,15,17,23H,7-10,12,14,16,18H2,1-6H3,(H-,25,26,27,28)/p+1 |
| InChIKey | XEBHZVFWJXWVDP-UHFFFAOYSA-O |
| XLogP | 6.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|