C14H26NO5P — CID 6475851
[1-[[(2E)-3,7-dimethylocta-2,6-dienoxy]amino]-1-oxobutan-2-yl]phosphonic acid (PubChem CID 6475851) has the molecular formula C14H26NO5P and a molecular weight of 319.34 g/mol. Its IUPAC name is [1-[[(2E)-3,7-dimethylocta-2,6-dienoxy]amino]-1-oxobutan-2-yl]phosphonic acid.
| Compound Name | [1-[[(2E)-3,7-dimethylocta-2,6-dienoxy]amino]-1-oxobutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 6475851 |
| Molecular Formula | C14H26NO5P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [1-[[(2E)-3,7-dimethylocta-2,6-dienoxy]amino]-1-oxobutan-2-yl]phosphonic acid |
| SMILES | CCC(C(=O)NOC/C=C(\C)CCC=C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C14H26NO5P/c1-5-13(21(17,18)19)14(16)15-20-10-9-12(4)8-6-7-11(2)3/h7,9,13H,5-6,8,10H2,1-4H3,(H,15,16)(H2,17,18,19)/b12-9+ |
| InChIKey | MWGPOXCVKWOFFH-FMIVXFBMSA-N |
| XLogP | 2.68 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|