C20H21ClN2O4 — CID 9220756
N'-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-2-methylbenzohydrazide (PubChem CID 9220756) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is N'-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-2-methylbenzohydrazide.
| Compound Name | N'-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 9220756 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N'-[(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoyl]-2-methylbenzohydrazide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NNC(=O)c2ccccc2C)cc1OC |
| InChI | InChI=1S/C20H21ClN2O4/c1-4-27-19-16(21)11-14(12-17(19)26-3)9-10-18(24)22-23-20(25)15-8-6-5-7-13(15)2/h5-12H,4H2,1-3H3,(H,22,24)(H,23,25)/b10-9+ |
| InChIKey | OBQZMHDEUQRKRH-MDZDMXLPSA-N |
| XLogP | 3.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|