C18H26N4O5 — CID 92509136
(4R,4aR,5R,8aS)-3,5,8-trimethyl-4-(3,4,5-trimethoxyphenyl)-1,4,4a,5,6,8a-hexahydropyrimido[4,5-d]pyrimidine-2,7-dione (PubChem CID 92509136) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4R,4aR,5R,8aS)-3,5,8-trimethyl-4-(3,4,5-trimethoxyphenyl)-1,4,4a,5,6,8a-hexahydropyrimido[4,5-d]pyrimidine-2,7-dione.
| Compound Name | (4R,4aR,5R,8aS)-3,5,8-trimethyl-4-(3,4,5-trimethoxyphenyl)-1,4,4a,5,6,8a-hexahydropyrimido[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 92509136 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (4R,4aR,5R,8aS)-3,5,8-trimethyl-4-(3,4,5-trimethoxyphenyl)-1,4,4a,5,6,8a-hexahydropyrimido[4,5-d]pyrimidine-2,7-dione |
| SMILES | COc1cc([C@H]2[C@@H]3[C@@H](NC(=O)N2C)N(C)C(=O)N[C@@H]3C)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N4O5/c1-9-13-14(10-7-11(25-4)15(27-6)12(8-10)26-5)21(2)18(24)20-16(13)22(3)17(23)19-9/h7-9,13-14,16H,1-6H3,(H,19,23)(H,20,24)/t9-,13-,14+,16+/m1/s1 |
| InChIKey | XVKOVXCOQLTEBC-QWSMXIIPSA-N |
| XLogP | 1.39 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |